CAS 166175-35-5 is the registry number for Bexarotene-d3. Offered by: TRC. Available pack sizes: 25mg.
4-[1-[5,5,8,8-tetramethyl-3-(trideuteriomethyl)-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid (CAS 166175-35-5) is a chemical compound with the molecular formula C24H28O2 and a molecular weight of 351.5 g/mol. IUPAC name: 4-[1-[5,5,8,8-tetramethyl-3-(trideuteriomethyl)-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid. InChIKey: NAVMQTYZDKMPEU-FIBGUPNXSA-N.
| Molecular formula | C24H28O2 |
|---|---|
| Molecular weight | 351.5 g/mol |
| IUPAC name | 4-[1-[5,5,8,8-tetramethyl-3-(trideuteriomethyl)-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid |
| InChIKey | NAVMQTYZDKMPEU-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC2=C(C=C1C(=C)C3=CC=C(C=C3)C(=O)O)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)