Products 234447-07-5
CAS 234447-07-5 is the registry number for (5R,11R)-5,11-Diethyl-2,8-dimethoxy-5,6,11,12-tetrahydrochrysene. Offered by: TRC. Available pack sizes: 250mg.
(5R,11R)-5,11-diethyl-2,8-dimethoxy-5,6,11,12-tetrahydrochrysene (CAS 234447-07-5) is a chemical compound with the molecular formula C24H28O2 and a molecular weight of 348.5 g/mol. IUPAC name: (5R,11R)-5,11-diethyl-2,8-dimethoxy-5,6,11,12-tetrahydrochrysene. InChIKey: OXNGTFQCCCFINI-HZPDHXFCSA-N.
| Molecular formula | C24H28O2 |
|---|---|
| Molecular weight | 348.5 g/mol |
| IUPAC name | (5R,11R)-5,11-diethyl-2,8-dimethoxy-5,6,11,12-tetrahydrochrysene |
| InChIKey | OXNGTFQCCCFINI-HZPDHXFCSA-N |
| SMILES | CC[C@@H]1CC2=C(C=CC(=C2)OC)C3=C1C4=C(C[C@H]3CC)C=C(C=C4)OC |
Computed by PubChem (NCBI)