Products 2182068-00-2
CAS 2182068-00-2 appears in our catalog under these names: Bexarotene D4, Bexarotene–d4, Bexarotene-d4, 98.51%, Bexarotene-d4, 99.11%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 500μg, 1 mg, 10 mg, 5 mg.
2,3,5,6-tetradeuterio-4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid (CAS 2182068-00-2) is a chemical compound with the molecular formula C24H28O2 and a molecular weight of 352.5 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid. InChIKey: NAVMQTYZDKMPEU-ULDPCNCHSA-N.
| Molecular formula | C24H28O2 |
|---|---|
| Molecular weight | 352.5 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid |
| InChIKey | NAVMQTYZDKMPEU-ULDPCNCHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=C)C2=CC3=C(C=C2C)C(CCC3(C)C)(C)C)[2H])[2H])C(=O)O)[2H] |
Computed by PubChem (NCBI)