cas: 312965-04-1 — see every product listed under this CAS number, including other names
4-{[(9h-fluoren-9-yl)methoxy]carbonyl}morpholine-2-carboxylic acid, 95% (CAS 312965-04-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F640147-250MG |
| cas | 312965-04-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 500mg | 320.74 Pln | |
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 5g | 2002.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-2-carboxylic acid (CAS 312965-04-1) is a chemical compound with the molecular formula C20H19NO5 and a molecular weight of 353.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-2-carboxylic acid. InChIKey: TUZVFPRISNDQLQ-UHFFFAOYSA-N.
| Molecular formula | C20H19NO5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-2-carboxylic acid |
| InChIKey | TUZVFPRISNDQLQ-UHFFFAOYSA-N |
| SMILES | C1COC(CN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)