CAS 1629738-61-9 appears in our catalog under these names: 2,4-Morpholinedicarboxylic acid, 4-(9H-fluoren-9-ylmethyl) ester, (2S)-, 98%, (2S)-4-{((9H-Fluoren-9-yl)methoxy)carbonyl}morpholine-2-carboxylic acid, (2S)-4-[[(9H-Fluoren-9-yl)methoxy]carbonyl]morpholine-2-carboxylic acid, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 1g.
(2S)-4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-2-carboxylic acid (CAS 1629738-61-9) is a chemical compound with the molecular formula C20H19NO5 and a molecular weight of 353.4 g/mol. IUPAC name: (2S)-4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-2-carboxylic acid. InChIKey: TUZVFPRISNDQLQ-SFHVURJKSA-N.
| Molecular formula | C20H19NO5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2S)-4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-2-carboxylic acid |
| InChIKey | TUZVFPRISNDQLQ-SFHVURJKSA-N |
| SMILES | C1CO[C@@H](CN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)