cas: 102362-04-9 — see every product listed under this CAS number, including other names
4-Acetyl-2-methoxybenzoic acid, 97% (CAS 102362-04-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F607520-100MG |
| cas | 102362-04-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 263.47 Pln | |
| Fluorochem | 250mg | 346.77 Pln | |
| Fluorochem | 1g | 924.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-acetyl-2-methoxybenzoic acid (CAS 102362-04-9) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 4-acetyl-2-methoxybenzoic acid. InChIKey: OFDZQWIOLLRCOX-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 4-acetyl-2-methoxybenzoic acid |
| InChIKey | OFDZQWIOLLRCOX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)C(=O)O)OC |
Computed by PubChem (NCBI)