CAS 56011-75-7 appears in our catalog under these names: 2,2-Dimethyl-1,3-benzodioxole-5-carboxylic acid, 95%, 2,2-Dimethylbenzo(d)(1,3)dioxole-5-carboxylic acid, 98+%, 2,2-Dimethylbenzo[d][1,3]dioxole-5-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
2,2-dimethyl-1,3-benzodioxole-5-carboxylic acid (CAS 56011-75-7) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 2,2-dimethyl-1,3-benzodioxole-5-carboxylic acid. InChIKey: GMULXWRTLFQMEG-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 2,2-dimethyl-1,3-benzodioxole-5-carboxylic acid |
| InChIKey | GMULXWRTLFQMEG-UHFFFAOYSA-N |
| SMILES | CC1(OC2=C(O1)C=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)