cas: 586-89-0 — see every product listed under this CAS number, including other names
4-Acetylbenzoic acid, 95% (CAS 586-89-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F021711-5G |
| cas | 586-89-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 122.89 Pln | |
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 508.17 Pln | |
| Fluorochem | 500g | 2189.87 Pln | |
| Fluorochem | 1kg | 3642.49 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-acetylbenzoic acid (CAS 586-89-0) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. IUPAC name: 4-acetylbenzoic acid. InChIKey: QBHDSQZASIBAAI-UHFFFAOYSA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 4-acetylbenzoic acid |
| InChIKey | QBHDSQZASIBAAI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)