CAS 586-89-0 appears in our catalog under these names: 4-Acetylbenzoic acid, 97%, 4-Acetylbenzoic Acid, 4-Acetylbenzoic Acid, >95% (HPLC), 4-Acetylbenzoic acid/ 98+%, 4–Acetylbenzoic Acid. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, Chemat. Available pack sizes: 25g, 500g, 5g, 1g, 100g, on request, 50g, 25mg.
4-acetylbenzoic acid (CAS 586-89-0) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. IUPAC name: 4-acetylbenzoic acid. InChIKey: QBHDSQZASIBAAI-UHFFFAOYSA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 4-acetylbenzoic acid |
| InChIKey | QBHDSQZASIBAAI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)