cas: 586-89-0 — see every product listed under this CAS number, including other names
4-Acetylbenzoic acid, 98% (CAS 586-89-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1G. Offered by: Thermo Scientific (Acros), Sigma-Aldrich.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 175860100 |
| cas | 586-89-0 |
| size | 10g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 10g | 390.21 Pln | |
| Sigma-Aldrich | 10G | 1030.00 Pln | |
| Sigma-Aldrich | 1G | 222.00 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
4-acetylbenzoic acid (CAS 586-89-0) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. IUPAC name: 4-acetylbenzoic acid. InChIKey: QBHDSQZASIBAAI-UHFFFAOYSA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 4-acetylbenzoic acid |
| InChIKey | QBHDSQZASIBAAI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)