4-Acetylbenzoic acid, 98%
cas: 586-89-0 — see every product listed under this CAS number, including other names
4-Acetylbenzoic acid, 98% (CAS 586-89-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 50g, 100g, 250g, 500g. Offered by: Thermo Scientific (Acros), Chemat.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 175860100 |
| cas | 586-89-0 |
| size | 10g |
| availability | availability |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 10g | 390.21 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 122.00 Pln | |
| Chemat | 50g | 184.40 Pln | |
| Chemat | 100g | 304.40 Pln | |
| Chemat | 250g | 659.60 Pln | |
| Chemat | 500g | 1305.60 Pln | |
| Chemat | 1kg | 1648.40 Pln | |
| Chemat | 5kg | 8068.80 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
4-acetylbenzoic acid (CAS 586-89-0) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. IUPAC name: 4-acetylbenzoic acid. InChIKey: QBHDSQZASIBAAI-UHFFFAOYSA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 4-acetylbenzoic acid |
| InChIKey | QBHDSQZASIBAAI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)
