cas: 586-89-0 — see every product listed under this CAS number, including other names
4-Acetylbenzoic acid, 99.76% (CAS 586-89-0) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 100 g, 10mM/1mL, 25 g, 500 g, 50 g, 250 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W001939-10 g |
| cas | 586-89-0 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 263.96 Pln | |
| MedChemExpress | 100 g | 765.52 Pln | |
| MedChemExpress | 10mM/1mL | 277.90 Pln | |
| MedChemExpress | 25 g | 407.93 Pln | |
| MedChemExpress | 500 g | 2061.19 Pln | |
| MedChemExpress | 50 g | 551.89 Pln | |
| MedChemExpress | 250 g | 1415.68 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.76% |
4-acetylbenzoic acid (CAS 586-89-0) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. IUPAC name: 4-acetylbenzoic acid. InChIKey: QBHDSQZASIBAAI-UHFFFAOYSA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 4-acetylbenzoic acid |
| InChIKey | QBHDSQZASIBAAI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)