cas: 2840-00-8 — see every product listed under this CAS number, including other names
4-Amino-3,5-dichloro-2,6-difluoropyridine, 97% (CAS 2840-00-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F005381-5G |
| cas | 2840-00-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 25g | 409.25 Pln | |
| Fluorochem | 100g | 1143.37 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3,5-dichloro-2,6-difluoropyridin-4-amine (CAS 2840-00-8) is a chemical compound with the molecular formula C5H2Cl2F2N2 and a molecular weight of 198.98 g/mol. IUPAC name: 3,5-dichloro-2,6-difluoropyridin-4-amine. InChIKey: BEGINUFBBRTGBH-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2F2N2 |
|---|---|
| Molecular weight | 198.98 g/mol |
| IUPAC name | 3,5-dichloro-2,6-difluoropyridin-4-amine |
| InChIKey | BEGINUFBBRTGBH-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=NC(=C1Cl)F)F)Cl)N |
Computed by PubChem (NCBI)