Products 1807617-94-2
CAS 1807617-94-2 appears in our catalog under these names: 2,4-Dichloro-5-(difluoromethyl)pyrimidine, 95%, 95%, 2,4-Dichloro-5-(difluoromethyl)pyrimidine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 500mg, 5g.
2,4-dichloro-5-(difluoromethyl)pyrimidine (CAS 1807617-94-2) is a chemical compound with the molecular formula C5H2Cl2F2N2 and a molecular weight of 198.98 g/mol. IUPAC name: 2,4-dichloro-5-(difluoromethyl)pyrimidine. InChIKey: MHWMASHRIADZLN-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2F2N2 |
|---|---|
| Molecular weight | 198.98 g/mol |
| IUPAC name | 2,4-dichloro-5-(difluoromethyl)pyrimidine |
| InChIKey | MHWMASHRIADZLN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)Cl)Cl)C(F)F |
Computed by PubChem (NCBI)