CAS 1443290-45-6 is the registry number for 4,6-Dichloro-5-(difluoromethyl)pyrimidine, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4,6-dichloro-5-(difluoromethyl)pyrimidine (CAS 1443290-45-6) is a chemical compound with the molecular formula C5H2Cl2F2N2 and a molecular weight of 198.98 g/mol. IUPAC name: 4,6-dichloro-5-(difluoromethyl)pyrimidine. InChIKey: PKVJMACXCLXTKX-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2F2N2 |
|---|---|
| Molecular weight | 198.98 g/mol |
| IUPAC name | 4,6-dichloro-5-(difluoromethyl)pyrimidine |
| InChIKey | PKVJMACXCLXTKX-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(C(=N1)Cl)C(F)F)Cl |
Computed by PubChem (NCBI)