Products 1121583-29-6
CAS 1121583-29-6 appears in our catalog under these names: 2,6-Dichloro-3,5-difluoropyridin-4-amine 98%, 2,6-Dichloro-3,5-difluoropyridin-4-amine, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 25mg, 50mg, 100mg.
2,6-dichloro-3,5-difluoropyridin-4-amine (CAS 1121583-29-6) is a chemical compound with the molecular formula C5H2Cl2F2N2 and a molecular weight of 198.98 g/mol. IUPAC name: 2,6-dichloro-3,5-difluoropyridin-4-amine. InChIKey: TWUISKGMAQMYBL-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2F2N2 |
|---|---|
| Molecular weight | 198.98 g/mol |
| IUPAC name | 2,6-dichloro-3,5-difluoropyridin-4-amine |
| InChIKey | TWUISKGMAQMYBL-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=NC(=C1F)Cl)Cl)F)N |
Computed by PubChem (NCBI)