cas: 1004761-68-5 — see every product listed under this CAS number, including other names
4-Amino-3,5-dimethylphenylboronic acid, pinacol ester, 97%, 97% (CAS 1004761-68-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11133N-100mg |
| cas | 1004761-68-5 |
| size | 100mg |
| availability | 7.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 856.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1004761-68-5) is a chemical compound with the molecular formula C14H22BNO2 and a molecular weight of 247.14 g/mol. IUPAC name: 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: SBYDVNRAKVMVMG-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO2 |
|---|---|
| Molecular weight | 247.14 g/mol |
| IUPAC name | 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | SBYDVNRAKVMVMG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)C)N)C |
Computed by PubChem (NCBI)