Products 84526-36-3

CAS 84526-36-3 is the registry number for Phenylboronic acid n-butyldiethanolamine ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g.

Structural formula: {0} (CAS {1})

6-butyl-2-phenyl-1,3,6,2-dioxazaborocane (CAS 84526-36-3) is a chemical compound with the molecular formula C14H22BNO2 and a molecular weight of 247.14 g/mol. IUPAC name: 6-butyl-2-phenyl-1,3,6,2-dioxazaborocane. InChIKey: XBJLGTGASXIEFZ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H22BNO2
Molecular weight247.14 g/mol
IUPAC name6-butyl-2-phenyl-1,3,6,2-dioxazaborocane
InChIKeyXBJLGTGASXIEFZ-UHFFFAOYSA-N
SMILESB1(OCCN(CCO1)CCCC)C2=CC=CC=C2

Computed by PubChem (NCBI)