CAS 1392846-26-2 is the registry number for N,2-Dimethyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N,2-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1392846-26-2) is a chemical compound with the molecular formula C14H22BNO2 and a molecular weight of 247.14 g/mol. IUPAC name: N,2-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: UTCSSLNPPCBIOC-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO2 |
|---|---|
| Molecular weight | 247.14 g/mol |
| IUPAC name | N,2-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | UTCSSLNPPCBIOC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)NC)C |
Computed by PubChem (NCBI)