CAS 2223035-51-4 is the registry number for 4-Isopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-propan-2-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2223035-51-4) is a chemical compound with the molecular formula C14H22BNO2 and a molecular weight of 247.14 g/mol. IUPAC name: 4-propan-2-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: YVJAUQPMXFKGGR-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO2 |
|---|---|
| Molecular weight | 247.14 g/mol |
| IUPAC name | 4-propan-2-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | YVJAUQPMXFKGGR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC=CC(=C2)C(C)C |
Computed by PubChem (NCBI)