cas: 400-98-6 — see every product listed under this CAS number, including other names
4-Amino-3-nitrobenzotrifluoride 98% (CAS 400-98-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A761375-10g |
| cas | 400-98-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 353.69 Pln | |
| Ambeed | 500g | 1477.31 Pln | |
| Ambeed | 1000g | 2689.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A761375 |
2-nitro-4-(trifluoromethyl)aniline (CAS 400-98-6) is a chemical compound with the molecular formula C7H5F3N2O2 and a molecular weight of 206.12 g/mol. IUPAC name: 2-nitro-4-(trifluoromethyl)aniline. InChIKey: ATXBGHLILIABGX-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O2 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 2-nitro-4-(trifluoromethyl)aniline |
| InChIKey | ATXBGHLILIABGX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])N |
Computed by PubChem (NCBI)