cas: 400-98-6 — see every product listed under this CAS number, including other names
4-Amino-3-nitrobenzotrifluoride, 98%, 98% (CAS 400-98-6) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148WA-50g |
| cas | 400-98-6 |
| size | 50g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 160.40 Pln | |
| Chemat | 250g | 554.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 112.40 Pln | |
| Chemat | 100g | 261.20 Pln | |
| Chemat | 500g | 1113.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-nitro-4-(trifluoromethyl)aniline (CAS 400-98-6) is a chemical compound with the molecular formula C7H5F3N2O2 and a molecular weight of 206.12 g/mol. IUPAC name: 2-nitro-4-(trifluoromethyl)aniline. InChIKey: ATXBGHLILIABGX-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O2 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 2-nitro-4-(trifluoromethyl)aniline |
| InChIKey | ATXBGHLILIABGX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])N |
Computed by PubChem (NCBI)