cas: 539-17-3 — see every product listed under this CAS number, including other names
4-Amino-4'-dimethylaminoazobenzene, >97.0%(HPLC)(T) (CAS 539-17-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A1672-1G |
| cas | 539-17-3 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 541.23 Pln | |
| TCI | 5g | 2060.66 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(HPLC)(T) |
4-[[4-(dimethylamino)phenyl]diazenyl]aniline (CAS 539-17-3) is a chemical compound with the molecular formula C14H16N4 and a molecular weight of 240.30 g/mol. IUPAC name: 4-[[4-(dimethylamino)phenyl]diazenyl]aniline. InChIKey: BVRIUXYMUSKBHG-UHFFFAOYSA-N.
| Molecular formula | C14H16N4 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 4-[[4-(dimethylamino)phenyl]diazenyl]aniline |
| InChIKey | BVRIUXYMUSKBHG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)