cas: 539-17-3 — see every product listed under this CAS number, including other names
N,N-Dimethyl-4,4-azodianiline, 98% (CAS 539-17-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A601319-250mg |
| cas | 539-17-3 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 323.89 Pln | |
| AmBeed | 100mg | 213.22 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-[[4-(dimethylamino)phenyl]diazenyl]aniline (CAS 539-17-3) is a chemical compound with the molecular formula C14H16N4 and a molecular weight of 240.30 g/mol. IUPAC name: 4-[[4-(dimethylamino)phenyl]diazenyl]aniline. InChIKey: BVRIUXYMUSKBHG-UHFFFAOYSA-N.
| Molecular formula | C14H16N4 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 4-[[4-(dimethylamino)phenyl]diazenyl]aniline |
| InChIKey | BVRIUXYMUSKBHG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)