cas: 155255-45-1 — see every product listed under this CAS number, including other names
4-Amino-5-bromo-2-(trifluoromethyl)benzonitrile, 96%, 96% (CAS 155255-45-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112NQV-5g |
| cas | 155255-45-1 |
| size | 5g |
| availability | 156.85g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 232.40 Pln | |
| Chemat | 10g | 357.20 Pln | |
| Chemat | 25g | 626.00 Pln | |
| Chemat | 50g | 1134.80 Pln | |
| Chemat | 100g | 2123.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
4-amino-5-bromo-2-(trifluoromethyl)benzonitrile (CAS 155255-45-1) is a chemical compound with the molecular formula C8H4BrF3N2 and a molecular weight of 265.03 g/mol. IUPAC name: 4-amino-5-bromo-2-(trifluoromethyl)benzonitrile. InChIKey: VDQSOTIHVAEDDZ-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3N2 |
|---|---|
| Molecular weight | 265.03 g/mol |
| IUPAC name | 4-amino-5-bromo-2-(trifluoromethyl)benzonitrile |
| InChIKey | VDQSOTIHVAEDDZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)N)C(F)(F)F)C#N |
Computed by PubChem (NCBI)