CAS 150780-40-8 appears in our catalog under these names: 6-Bromo-2-(trifluoromethyl)imidazo[1,2-a]pyridine, 97%, 6-Bromo-2-trifluoromethylimidazo(1,2-a)pyridine, 98%, 6–bromo–2–(trifluoromethyl)imidazo(1,2–a)pyridine, 6-Bromo-2-trifluoromethylimidazo[1,2-a]pyridine, 98%, 98%, 6-Bromo-2-trifluoromethylimidazo[1,2-a]pyridine, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 1g, 5g, 100mg, 2g.
6-bromo-2-(trifluoromethyl)imidazo[1,2-a]pyridine (CAS 150780-40-8) is a chemical compound with the molecular formula C8H4BrF3N2 and a molecular weight of 265.03 g/mol. IUPAC name: 6-bromo-2-(trifluoromethyl)imidazo[1,2-a]pyridine. InChIKey: ZDNCRDVYCJEJPX-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3N2 |
|---|---|
| Molecular weight | 265.03 g/mol |
| IUPAC name | 6-bromo-2-(trifluoromethyl)imidazo[1,2-a]pyridine |
| InChIKey | ZDNCRDVYCJEJPX-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1Br)C(F)(F)F |
Computed by PubChem (NCBI)