CAS 1417334-55-4 appears in our catalog under these names: 6-Bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridine, 95%, 6-Bromo-8-(trifluoromethyl)imidazo(1,2-a)pyridine, 97%, 6-Bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridine, 95%, 95%, 6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridine. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridine (CAS 1417334-55-4) is a chemical compound with the molecular formula C8H4BrF3N2 and a molecular weight of 265.03 g/mol. IUPAC name: 6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridine. InChIKey: JZVYHKXYTNZPJN-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3N2 |
|---|---|
| Molecular weight | 265.03 g/mol |
| IUPAC name | 6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridine |
| InChIKey | JZVYHKXYTNZPJN-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C=C(C2=N1)C(F)(F)F)Br |
Computed by PubChem (NCBI)