Products 1262619-64-6
CAS 1262619-64-6 appears in our catalog under these names: 6-Bromo-3-(trifluoromethyl)imidazo[1,5-a]pyridine, 95%, 6-Bromo-3-(trifluoromethyl)imidazo(1,5-a)pyridine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
6-bromo-3-(trifluoromethyl)imidazo[1,5-a]pyridine (CAS 1262619-64-6) is a chemical compound with the molecular formula C8H4BrF3N2 and a molecular weight of 265.03 g/mol. IUPAC name: 6-bromo-3-(trifluoromethyl)imidazo[1,5-a]pyridine. InChIKey: UTLXLZJNPABBDG-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3N2 |
|---|---|
| Molecular weight | 265.03 g/mol |
| IUPAC name | 6-bromo-3-(trifluoromethyl)imidazo[1,5-a]pyridine |
| InChIKey | UTLXLZJNPABBDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN2C1=CN=C2C(F)(F)F)Br |
Computed by PubChem (NCBI)