cas: 1709-59-7 — see every product listed under this CAS number, including other names
4-Amino-N,N-dimethylbenzenesulfonamide, 95%, 95% (CAS 1709-59-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11499E-250mg |
| cas | 1709-59-7 |
| size | 250mg |
| availability | 144g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 10g | 299.60 Pln | |
| Chemat | 25g | 606.80 Pln | |
| Chemat | 50g | 1101.20 Pln | |
| Chemat | 100g | 2094.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-amino-N,N-dimethylbenzenesulfonamide (CAS 1709-59-7) is a chemical compound with the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. IUPAC name: 4-amino-N,N-dimethylbenzenesulfonamide. InChIKey: BABGMPQXLCJMSK-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 4-amino-N,N-dimethylbenzenesulfonamide |
| InChIKey | BABGMPQXLCJMSK-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)