cas: 1709-59-7 — see every product listed under this CAS number, including other names
4-Amino-N,N-dimethyl-benzenesulfonamide, 95% (CAS 1709-59-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F060387-1G |
| cas | 1709-59-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 279.09 Pln | |
| Fluorochem | 25g | 981.96 Pln | |
| Fluorochem | 100g | 3455.05 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-amino-N,N-dimethylbenzenesulfonamide (CAS 1709-59-7) is a chemical compound with the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. IUPAC name: 4-amino-N,N-dimethylbenzenesulfonamide. InChIKey: BABGMPQXLCJMSK-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 4-amino-N,N-dimethylbenzenesulfonamide |
| InChIKey | BABGMPQXLCJMSK-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)