cas: 4862-94-6 — see every product listed under this CAS number, including other names
4-Amino-N-(2-hydroxyethyl)benzenesulfonamide, 97%, 97% (CAS 4862-94-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DL0D-100mg |
| cas | 4862-94-6 |
| size | 100mg |
| availability | 45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 707.60 Pln | |
| Chemat | 5g | 2805.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-amino-N-(2-hydroxyethyl)benzenesulfonamide (CAS 4862-94-6) is a chemical compound with the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. IUPAC name: 4-amino-N-(2-hydroxyethyl)benzenesulfonamide. InChIKey: NLESYSQTERIDQP-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O3S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 4-amino-N-(2-hydroxyethyl)benzenesulfonamide |
| InChIKey | NLESYSQTERIDQP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)NCCO |
Computed by PubChem (NCBI)