CAS 2665010-40-0 is the registry number for Iminomethanaminium 4-methylbenzene-1-sulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Aminomethylideneazanium;4-methylbenzenesulfonate (CAS 2665010-40-0) is a chemical compound with the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. IUPAC name: aminomethylideneazanium;4-methylbenzenesulfonate. InChIKey: AWFWHHTXLQOBER-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O3S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | aminomethylideneazanium;4-methylbenzenesulfonate |
| InChIKey | AWFWHHTXLQOBER-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].C(=[NH2+])N |
Computed by PubChem (NCBI)