CAS 539807-29-9 appears in our catalog under these names: N'-(3-Hydroxyphenyl)-n,n-dimethylsulfamide, 95%, N'-(3-Hydroxyphenyl)-N,N-dimethylsulfamide, 97%, N'-(3-Hydroxyphenyl)-N,N-dimethylsulfamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g.
1-(dimethylsulfamoylamino)-3-hydroxybenzene (CAS 539807-29-9) is a chemical compound with the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. IUPAC name: 1-(dimethylsulfamoylamino)-3-hydroxybenzene. InChIKey: AHZQSWQALJXNQV-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O3S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 1-(dimethylsulfamoylamino)-3-hydroxybenzene |
| InChIKey | AHZQSWQALJXNQV-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)NC1=CC(=CC=C1)O |
Computed by PubChem (NCBI)