CAS 24962-75-2 is the registry number for 3-Amino-4-hydroxy-N,N-dimethylbenzenesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
3-amino-4-hydroxy-N,N-dimethylbenzenesulfonamide (CAS 24962-75-2) is a chemical compound with the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. IUPAC name: 3-amino-4-hydroxy-N,N-dimethylbenzenesulfonamide. InChIKey: BLKRLPPJSAMUNN-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O3S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 3-amino-4-hydroxy-N,N-dimethylbenzenesulfonamide |
| InChIKey | BLKRLPPJSAMUNN-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=C(C=C1)O)N |
Computed by PubChem (NCBI)