cas: 59404-86-3 — see every product listed under this CAS number, including other names
4-BENZYLOXY-3-CHLOROANILINE, 98%(GC-MS),RG, 98%(GC-MS),RG (CAS 59404-86-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KT0-100mg |
| cas | 59404-86-3 |
| size | 100mg |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 386.00 Pln | |
| Chemat | 5g | 1427.60 Pln |
| purity | 98%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
3-chloro-4-phenylmethoxyaniline (CAS 59404-86-3) is a chemical compound with the molecular formula C13H12ClNO and a molecular weight of 233.69 g/mol. IUPAC name: 3-chloro-4-phenylmethoxyaniline. InChIKey: WOWKZTBVWKKGJV-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 3-chloro-4-phenylmethoxyaniline |
| InChIKey | WOWKZTBVWKKGJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)