cas: 437764-46-0 — see every product listed under this CAS number, including other names
4-BROMO-2-FLUORO-BENZOIC ACID BENZYL ESTER, 97%, 97% (CAS 437764-46-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12SY9K-1g |
| cas | 437764-46-0 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2474.00 Pln | |
| Chemat | 5g | 7043.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl 4-bromo-2-fluorobenzoate (CAS 437764-46-0) is a chemical compound with the molecular formula C14H10BrFO2 and a molecular weight of 309.13 g/mol. IUPAC name: benzyl 4-bromo-2-fluorobenzoate. InChIKey: JTXNSDOLYAYGAB-UHFFFAOYSA-N.
| Molecular formula | C14H10BrFO2 |
|---|---|
| Molecular weight | 309.13 g/mol |
| IUPAC name | benzyl 4-bromo-2-fluorobenzoate |
| InChIKey | JTXNSDOLYAYGAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)