CAS 1114809-05-0 appears in our catalog under these names: 3-Benzyloxy-6-bromo-2-fluorobenzaldehyde, 95%, 3-(Benzyloxy)-6-bromo-2-fluorobenzaldehyde, 95+%, 3-Benzyloxy-6-bromo-2-fluorobenzaldehyde. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
6-bromo-2-fluoro-3-phenylmethoxybenzaldehyde (CAS 1114809-05-0) is a chemical compound with the molecular formula C14H10BrFO2 and a molecular weight of 309.13 g/mol. IUPAC name: 6-bromo-2-fluoro-3-phenylmethoxybenzaldehyde. InChIKey: GRIVHAIKQQBTIY-UHFFFAOYSA-N.
| Molecular formula | C14H10BrFO2 |
|---|---|
| Molecular weight | 309.13 g/mol |
| IUPAC name | 6-bromo-2-fluoro-3-phenylmethoxybenzaldehyde |
| InChIKey | GRIVHAIKQQBTIY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)Br)C=O)F |
Computed by PubChem (NCBI)