CAS 437764-46-0 appears in our catalog under these names: 4-Bromo-2-fluoro-benzoic acid benzyl ester, 95%, 4-BROMO-2-FLUORO-BENZOIC ACID BENZYL ESTER, 97%, 97%, Benzyl 4-bromo-2-fluorobenzoate, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 5g, 250mg, 1g.
Benzyl 4-bromo-2-fluorobenzoate (CAS 437764-46-0) is a chemical compound with the molecular formula C14H10BrFO2 and a molecular weight of 309.13 g/mol. IUPAC name: benzyl 4-bromo-2-fluorobenzoate. InChIKey: JTXNSDOLYAYGAB-UHFFFAOYSA-N.
| Molecular formula | C14H10BrFO2 |
|---|---|
| Molecular weight | 309.13 g/mol |
| IUPAC name | benzyl 4-bromo-2-fluorobenzoate |
| InChIKey | JTXNSDOLYAYGAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)