CAS 2244107-76-2 is the registry number for 2-Bromo-6-fluoro-3-phenylmethoxybenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
2-bromo-6-fluoro-3-phenylmethoxybenzaldehyde (CAS 2244107-76-2) is a chemical compound with the molecular formula C14H10BrFO2 and a molecular weight of 309.13 g/mol. IUPAC name: 2-bromo-6-fluoro-3-phenylmethoxybenzaldehyde. InChIKey: XEAVRWXHWWXERP-UHFFFAOYSA-N.
| Molecular formula | C14H10BrFO2 |
|---|---|
| Molecular weight | 309.13 g/mol |
| IUPAC name | 2-bromo-6-fluoro-3-phenylmethoxybenzaldehyde |
| InChIKey | XEAVRWXHWWXERP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)F)C=O)Br |
Computed by PubChem (NCBI)