CAS 40951-53-9 appears in our catalog under these names: Bromazepam Impurity 3, 2-(2-Amino-5-bromo-3-hydroxybenzoyl)pyridine. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 10mg, 5mg, 25mg, 50mg.
(2-amino-5-bromo-3-hydroxyphenyl)-pyridin-2-ylmethanone (CAS 40951-53-9) is a chemical compound with the molecular formula C12H9BrN2O2 and a molecular weight of 293.12 g/mol. IUPAC name: (2-amino-5-bromo-3-hydroxyphenyl)-pyridin-2-ylmethanone. InChIKey: KUOBJQMVMPYLLN-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O2 |
|---|---|
| Molecular weight | 293.12 g/mol |
| IUPAC name | (2-amino-5-bromo-3-hydroxyphenyl)-pyridin-2-ylmethanone |
| InChIKey | KUOBJQMVMPYLLN-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)C2=C(C(=CC(=C2)Br)O)N |
Computed by PubChem (NCBI)