CAS 798565-45-4 is the registry number for 1-Bromo-6,7-dimethoxyisoquinoline-4-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-6,7-dimethoxyisoquinoline-4-carbonitrile (CAS 798565-45-4) is a chemical compound with the molecular formula C12H9BrN2O2 and a molecular weight of 293.12 g/mol. IUPAC name: 1-bromo-6,7-dimethoxyisoquinoline-4-carbonitrile. InChIKey: ZGRKHHWBOVOZCX-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O2 |
|---|---|
| Molecular weight | 293.12 g/mol |
| IUPAC name | 1-bromo-6,7-dimethoxyisoquinoline-4-carbonitrile |
| InChIKey | ZGRKHHWBOVOZCX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=CN=C2Br)C#N)OC |
Computed by PubChem (NCBI)