4-Bromoisoquinoline 2-oxide, 95%
cas: 3749-21-1 — see every product listed under this CAS number, including other names
4-Bromoisoquinoline 2-oxide, 95% (CAS 3749-21-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A810545-250mg |
| cas | 3749-21-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 804.25 Pln | |
| BLDpharm | 250mg | 181.07 Pln | |
| BLDpharm | 1g | 269.93 Pln | |
| BLDpharm | 5g | 864.16 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 654.80 Pln | |
| Fluorochem | 250mg | 206.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-bromo-2-oxidoisoquinolin-2-ium (CAS 3749-21-1) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 4-bromo-2-oxidoisoquinolin-2-ium. InChIKey: QGDQDTDMWYCQPV-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 4-bromo-2-oxidoisoquinolin-2-ium |
| InChIKey | QGDQDTDMWYCQPV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=[N+](C=C2Br)[O-] |
Computed by PubChem (NCBI)