cas: 769087-80-1 — see every product listed under this CAS number, including other names
4-Benzyl-morpholine-2-carboxylic acid, 95% (CAS 769087-80-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040695-1G |
| cas | 769087-80-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 331.15 Pln | |
| Fluorochem | 10g | 607.10 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-benzylmorpholine-2-carboxylic acid (CAS 769087-80-1) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 4-benzylmorpholine-2-carboxylic acid. InChIKey: UJDWIUOGWSDEFP-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 4-benzylmorpholine-2-carboxylic acid |
| InChIKey | UJDWIUOGWSDEFP-UHFFFAOYSA-N |
| SMILES | C1COC(CN1CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)