CAS 769087-80-1 appears in our catalog under these names: 4-Benzyl-morpholine-2-carboxylic acid, 97%, 4-Benzylmorpholine-2-carboxylic acid 98%, 4-Benzylmorpholine-2-carboxylic acid, 95%, 95%, 4-Benzyl-morpholine-2-carboxylic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 250mg, 100mg.
4-benzylmorpholine-2-carboxylic acid (CAS 769087-80-1) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 4-benzylmorpholine-2-carboxylic acid. InChIKey: UJDWIUOGWSDEFP-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 4-benzylmorpholine-2-carboxylic acid |
| InChIKey | UJDWIUOGWSDEFP-UHFFFAOYSA-N |
| SMILES | C1COC(CN1CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)