cas: 769087-80-1 — see every product listed under this CAS number, including other names
4-Benzylmorpholine-2-carboxylic acid, 95%, 95% (CAS 769087-80-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144WY-100mg |
| cas | 769087-80-1 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 280.40 Pln | |
| Chemat | 25g | 866.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-benzylmorpholine-2-carboxylic acid (CAS 769087-80-1) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 4-benzylmorpholine-2-carboxylic acid. InChIKey: UJDWIUOGWSDEFP-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 4-benzylmorpholine-2-carboxylic acid |
| InChIKey | UJDWIUOGWSDEFP-UHFFFAOYSA-N |
| SMILES | C1COC(CN1CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)