4-Benzyloxy-2-chlorophenylboronic acid, 97%
cas: 1315341-82-2 — see every product listed under this CAS number, including other names
4-Benzyloxy-2-chlorophenylboronic acid, 97% (CAS 1315341-82-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A168251-250mg |
| cas | 1315341-82-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 492.75 Pln | |
| BLDpharm | 1g | 208.84 Pln | |
| BLDpharm | 5g | 525.40 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 606.80 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 383.22 Pln | |
| Fluorochem | 5g | 1117.33 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(2-chloro-4-phenylmethoxyphenyl)boronic acid (CAS 1315341-82-2) is a chemical compound with the molecular formula C13H12BClO3 and a molecular weight of 262.50 g/mol. IUPAC name: (2-chloro-4-phenylmethoxyphenyl)boronic acid. InChIKey: DSJZHUNYMXRAJG-UHFFFAOYSA-N.
| Molecular formula | C13H12BClO3 |
|---|---|
| Molecular weight | 262.50 g/mol |
| IUPAC name | (2-chloro-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | DSJZHUNYMXRAJG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OCC2=CC=CC=C2)Cl)(O)O |
Computed by PubChem (NCBI)