Products 1315341-82-2
CAS 1315341-82-2 appears in our catalog under these names: 4-Benzyloxy-2-chlorophenylboronic acid 97%, 4-Benzyloxy-2-chlorophenylboronic acid, 97%, 4-Benzyloxy-2-chlorophenylboronic acid, 97%, 97%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g.
(2-chloro-4-phenylmethoxyphenyl)boronic acid (CAS 1315341-82-2) is a chemical compound with the molecular formula C13H12BClO3 and a molecular weight of 262.50 g/mol. IUPAC name: (2-chloro-4-phenylmethoxyphenyl)boronic acid. InChIKey: DSJZHUNYMXRAJG-UHFFFAOYSA-N.
| Molecular formula | C13H12BClO3 |
|---|---|
| Molecular weight | 262.50 g/mol |
| IUPAC name | (2-chloro-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | DSJZHUNYMXRAJG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OCC2=CC=CC=C2)Cl)(O)O |
Computed by PubChem (NCBI)