CAS 3597-91-9 appears in our catalog under these names: 4–Hydroxymethylbiphenyl, 4-Biphenylmethanol/ 98%, 4-Biphenylmethanol, 98+% , 4-Hydroxymethylbiphenyl, >99.0%(GC), 4-Biphenylmethanol. Offered by: GLPBio, Chemat, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 100g, 250g, 50g, 25g, 10g, 0,5kg, 0,25kg, 1kg.
(4-phenylphenyl)methanol (CAS 3597-91-9) is a chemical compound with the molecular formula C13H12O and a molecular weight of 184.23 g/mol. IUPAC name: (4-phenylphenyl)methanol. InChIKey: AXCHZLOJGKSWLV-UHFFFAOYSA-N.
| Molecular formula | C13H12O |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | (4-phenylphenyl)methanol |
| InChIKey | AXCHZLOJGKSWLV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)