cas: 2567-29-5 — see every product listed under this CAS number, including other names
4-Biphenylmethylbromide (CAS 2567-29-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211928-1G |
| cas | 2567-29-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 10g | 185.37 Pln | |
| Fluorochem | 25g | 299.91 Pln | |
| Fluorochem | 100g | 945.52 Pln |
| delivery time | 2-3 weeks |
|---|
1-(bromomethyl)-4-phenylbenzene (CAS 2567-29-5) is a chemical compound with the molecular formula C13H11Br and a molecular weight of 247.13 g/mol. IUPAC name: 1-(bromomethyl)-4-phenylbenzene. InChIKey: HZQLUIZFUXNFHK-UHFFFAOYSA-N.
| Molecular formula | C13H11Br |
|---|---|
| Molecular weight | 247.13 g/mol |
| IUPAC name | 1-(bromomethyl)-4-phenylbenzene |
| InChIKey | HZQLUIZFUXNFHK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CBr |
Computed by PubChem (NCBI)