cas: 1050424-03-7 — see every product listed under this CAS number, including other names
4-Borono-2-(trifluoromethyl)benzoic acid, 98%, 98% (CAS 1050424-03-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1101EV-250mg |
| cas | 1050424-03-7 |
| size | 250mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 213.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-borono-2-(trifluoromethyl)benzoic acid (CAS 1050424-03-7) is a chemical compound with the molecular formula C8H6BF3O4 and a molecular weight of 233.94 g/mol. IUPAC name: 4-borono-2-(trifluoromethyl)benzoic acid. InChIKey: WYTZBGVJUBFOBU-UHFFFAOYSA-N.
| Molecular formula | C8H6BF3O4 |
|---|---|
| Molecular weight | 233.94 g/mol |
| IUPAC name | 4-borono-2-(trifluoromethyl)benzoic acid |
| InChIKey | WYTZBGVJUBFOBU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)O)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)