cas: 72235-36-0 — see every product listed under this CAS number, including other names
4-Bromo-1,8-naphthyridin-2(1H)-one, ≥97%, ≥97% (CAS 72235-36-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DDAI-100mg |
| cas | 72235-36-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 5g | 5853.20 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
4-bromo-1H-1,8-naphthyridin-2-one (CAS 72235-36-0) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 4-bromo-1H-1,8-naphthyridin-2-one. InChIKey: IETZNQMOIMPLLC-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 4-bromo-1H-1,8-naphthyridin-2-one |
| InChIKey | IETZNQMOIMPLLC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC(=O)C=C2Br)N=C1 |
Computed by PubChem (NCBI)